
CAS 860787-00-4
:6,7,8,9,10,11-Hexahydro-1,4-dimethoxycycloocta[b]quinoline
Description:
6,7,8,9,10,11-Hexahydro-1,4-dimethoxycycloocta[b]quinoline is a bicyclic organic compound characterized by its complex polycyclic structure, which includes a quinoline moiety. This compound features six hydrogenated carbon atoms, contributing to its saturated nature, and two methoxy groups (-OCH3) that enhance its solubility and reactivity. The presence of these methoxy groups can influence its electronic properties and potential interactions in biological systems. The compound's unique structure may impart specific pharmacological activities, making it of interest in medicinal chemistry. Its CAS number, 860787-00-4, allows for precise identification in chemical databases. As with many organic compounds, its physical properties such as melting point, boiling point, and solubility can vary based on environmental conditions and the presence of other substances. Overall, this compound's structural features suggest potential applications in drug development or as a chemical intermediate in synthetic organic chemistry.
Formula:C17H21NO2
InChI:InChI=1S/C17H21NO2/c1-19-15-9-10-16(20-2)17-13(15)11-12-7-5-3-4-6-8-14(12)18-17/h9-11H,3-8H2,1-2H3
InChI key:InChIKey=ODLCWJHFXQSRME-UHFFFAOYSA-N
SMILES:O(C)C=1C2=C(C(OC)=CC1)N=C3C(=C2)CCCCCC3
Synonyms:- 6,7,8,9,10,11-Hexahydro-1,4-dimethoxycycloocta[b]quinoline
- Cycloocta[b]quinoline, 6,7,8,9,10,11-hexahydro-1,4-dimethoxy-
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.