CymitQuimica logo

CAS 860787-50-4

:

1,2,3-Trimethoxy-5-(2-propyn-1-yloxy)benzene

Description:
1,2,3-Trimethoxy-5-(2-propyn-1-yloxy)benzene, with the CAS number 860787-50-4, is an organic compound characterized by its complex structure featuring a benzene ring substituted with three methoxy groups and a propynyl ether. The presence of methoxy groups typically enhances the compound's solubility in organic solvents and may influence its reactivity and electronic properties. The propynyl group introduces a triple bond, which can participate in various chemical reactions, including nucleophilic additions and cycloadditions. This compound may exhibit interesting biological activities due to its structural features, making it a candidate for research in medicinal chemistry. Additionally, its unique functional groups could allow for further derivatization, potentially leading to the development of novel materials or pharmaceuticals. As with many organic compounds, its stability, reactivity, and potential applications would depend on the specific conditions under which it is used, including temperature, solvent, and the presence of catalysts or other reagents.
Formula:C12H14O4
InChI:InChI=1S/C12H14O4/c1-5-6-16-9-7-10(13-2)12(15-4)11(8-9)14-3/h1,7-8H,6H2,2-4H3
InChI key:InChIKey=OTQVXICYNQOPEB-UHFFFAOYSA-N
SMILES:O(C)C1=C(OC)C(OC)=CC(OCC#C)=C1
Synonyms:
  • Benzene, 1,2,3-trimethoxy-5-(2-propynyloxy)-
  • Benzene, 1,2,3-trimethoxy-5-(2-propyn-1-yloxy)-
  • 1,2,3-Trimethoxy-5-(2-propyn-1-yloxy)benzene
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 1 products.