CymitQuimica logo

CAS 860788-09-6

:

N-[1-[(4-Chlorophenyl)sulfonyl]-4-piperidinyl]benzamide

Description:
N-[1-[(4-Chlorophenyl)sulfonyl]-4-piperidinyl]benzamide, with the CAS number 860788-09-6, is a chemical compound characterized by its complex structure that includes a piperidine ring and a sulfonyl group attached to a chlorophenyl moiety. This compound typically exhibits properties such as being a solid at room temperature and having moderate solubility in organic solvents. It is often studied for its potential pharmacological applications, particularly in the field of medicinal chemistry, where it may act as a therapeutic agent due to its ability to interact with specific biological targets. The presence of the sulfonamide functional group can influence its reactivity and biological activity, making it a subject of interest in drug development. Additionally, the chlorophenyl group may contribute to its lipophilicity, affecting its absorption and distribution in biological systems. Overall, this compound represents a class of molecules that are valuable in the exploration of new therapeutic avenues.
Formula:C18H19ClN2O3S
InChI:InChI=1S/C18H19ClN2O3S/c19-15-6-8-17(9-7-15)25(23,24)21-12-10-16(11-13-21)20-18(22)14-4-2-1-3-5-14/h1-9,16H,10-13H2,(H,20,22)
InChI key:InChIKey=FVFOMMLQRWLQFX-UHFFFAOYSA-N
SMILES:S(=O)(=O)(N1CCC(NC(=O)C2=CC=CC=C2)CC1)C3=CC=C(Cl)C=C3
Synonyms:
  • Benzamide, N-[1-[(4-chlorophenyl)sulfonyl]-4-piperidinyl]-
  • N-[1-[(4-Chlorophenyl)sulfonyl]-4-piperidinyl]benzamide
Sort by

The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.