
CAS 860788-25-6
:1-[2-(4-Chlorophenyl)-4-methyl-5-thiazolyl]ethanone O-(4-chlorobenzoyl)oxime
Description:
1-[2-(4-Chlorophenyl)-4-methyl-5-thiazolyl]ethanone O-(4-chlorobenzoyl)oxime, with CAS number 860788-25-6, is a synthetic organic compound characterized by its complex structure, which includes a thiazole ring, chlorophenyl groups, and an oxime functional group. This compound typically exhibits properties such as moderate solubility in organic solvents and potential stability under standard laboratory conditions. The presence of the thiazole moiety suggests possible biological activity, as thiazoles are often found in pharmaceuticals and agrochemicals. The chlorophenyl substituents may influence its electronic properties and reactivity, potentially enhancing its interaction with biological targets. Additionally, the oxime functional group can participate in various chemical reactions, including condensation and rearrangement, making this compound of interest in synthetic chemistry. Overall, its unique structural features may contribute to its utility in research and development within medicinal chemistry and related fields.
Formula:C19H14Cl2N2O2S
InChI:InChI=1S/C19H14Cl2N2O2S/c1-11-17(26-18(22-11)13-3-7-15(20)8-4-13)12(2)23-25-19(24)14-5-9-16(21)10-6-14/h3-10H,1-2H3
InChI key:InChIKey=WHOGWUFFBCXMBA-UHFFFAOYSA-N
SMILES:C(=NOC(=O)C1=CC=C(Cl)C=C1)(C)C=2SC(=NC2C)C3=CC=C(Cl)C=C3
Synonyms:- 1-[2-(4-Chlorophenyl)-4-methyl-5-thiazolyl]ethanone O-(4-chlorobenzoyl)oxime
- Ethanone, 1-[2-(4-chlorophenyl)-4-methyl-5-thiazolyl]-, O-(4-chlorobenzoyl)oxime
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.