
CAS 860788-31-4
:4-[6-(4-Methylphenyl)imidazo[2,1-b]thiazol-5-yl]-3-buten-2-one
Description:
4-[6-(4-Methylphenyl)imidazo[2,1-b]thiazol-5-yl]-3-buten-2-one, with the CAS number 860788-31-4, is a synthetic organic compound characterized by its complex structure, which includes an imidazo-thiazole moiety and a butenone functional group. This compound typically exhibits properties such as moderate solubility in organic solvents and potential reactivity due to the presence of the α,β-unsaturated carbonyl group. Its molecular structure suggests potential biological activity, making it of interest in medicinal chemistry and drug development. The presence of the 4-methylphenyl group may influence its lipophilicity and interaction with biological targets. Additionally, compounds of this type may exhibit fluorescence or other photophysical properties, which can be useful in various applications, including imaging or as probes in biochemical assays. Overall, the characteristics of this compound make it a subject of interest for further research, particularly in the fields of pharmacology and organic synthesis.
Formula:C16H14N2OS
InChI:InChI=1S/C16H14N2OS/c1-11-3-6-13(7-4-11)15-14(8-5-12(2)19)18-9-10-20-16(18)17-15/h3-10H,1-2H3
InChI key:InChIKey=BMKHECMEWDTDLJ-UHFFFAOYSA-N
SMILES:C(=CC(C)=O)C1=C(N=C2N1C=CS2)C3=CC=C(C)C=C3
Synonyms:- 3-Buten-2-one, 4-[6-(4-methylphenyl)imidazo[2,1-b]thiazol-5-yl]-
- 4-[6-(4-Methylphenyl)imidazo[2,1-b]thiazol-5-yl]-3-buten-2-one
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.