CAS 860807-23-4

1-(Hydroxymethyl)-1H-pyrazole-3-carbonitrile

Description:

1-(Hydroxymethyl)-1H-pyrazole-3-carbonitrile is a chemical compound characterized by its pyrazole ring structure, which is a five-membered aromatic ring containing two adjacent nitrogen atoms. This compound features a hydroxymethyl group (-CH2OH) and a cyano group (-CN) attached to the pyrazole ring, contributing to its reactivity and potential applications in various fields, including pharmaceuticals and agrochemicals. The presence of the hydroxymethyl group enhances its solubility in polar solvents, while the cyano group can participate in nucleophilic reactions, making it a versatile intermediate in organic synthesis. The compound's molecular structure allows for potential interactions with biological targets, which may lead to the development of novel therapeutic agents. Additionally, its unique combination of functional groups may impart specific properties, such as increased stability or altered electronic characteristics, which can be exploited in material science or medicinal chemistry. As with many chemical substances, safety and handling precautions should be observed due to potential toxicity or reactivity.

Formula: C₅H₅N₃O

InChI: InChI=1S/C5H5N3O/c6-3-5-1-2-8(4-9)7-5/h1-2,9H,4H2

SMILES: c1cn(CO)nc1C#N

1-(Hydroxymethyl)-1H-pyrazole-3-carbonitrile

CAS: 860807-23-4

Formula: C₅H₅N₃O

Molecular weight: 123.1127

Ref: IN-DA01ALSP

1-(Hydroxymethyl)-1H-pyrazole-3-carbonitrile

CAS: 860807-23-4

Versatile small molecule scaffold

Formula: C₅H₅N₃O

Purity: Min. 95%

Molecular weight: 123.11 g/mol

Ref: 3D-KJB80723