CymitQuimica logo

CAS 860807-42-7

:

Methyl 1-(hydroxymethyl)-1H-pyrazole-4-carboxylate

Description:
Methyl 1-(hydroxymethyl)-1H-pyrazole-4-carboxylate, identified by its CAS number 860807-42-7, is a chemical compound that features a pyrazole ring, which is a five-membered aromatic heterocycle containing two nitrogen atoms. This compound is characterized by the presence of a carboxylate group and a hydroxymethyl substituent, which contribute to its reactivity and potential applications in various fields, including pharmaceuticals and agrochemicals. The methyl ester functional group enhances its solubility in organic solvents, making it suitable for various synthetic processes. Additionally, the hydroxymethyl group can participate in hydrogen bonding, influencing the compound's interactions with biological targets. Methyl 1-(hydroxymethyl)-1H-pyrazole-4-carboxylate may exhibit biological activity, which could be explored for its potential therapeutic effects. As with many pyrazole derivatives, it may also serve as a scaffold for the development of new compounds with enhanced properties. Safety and handling precautions should be observed, as with any chemical substance, due to potential toxicity or reactivity.
Formula:C6H8N2O3
InChI:InChI=1S/C6H8N2O3/c1-11-6(10)5-2-7-8(3-5)4-9/h2-3,9H,4H2,1H3
InChI key:InChIKey=TVHKOLTTWOCBRY-UHFFFAOYSA-N
SMILES:C(OC)(=O)C1=CN(CO)N=C1
Synonyms:
  • Methyl 1-(hydroxymethyl)-1H-pyrazole-4-carboxylate
  • 1H-Pyrazole-4-carboxylic acid, 1-(hydroxymethyl)-, methyl ester
Sort by

The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.