CAS 860807-43-8
:Methyl 1-(chloromethyl)-1H-pyrazole-4-carboxylate
Description:
Methyl 1-(chloromethyl)-1H-pyrazole-4-carboxylate is a chemical compound characterized by its pyrazole ring structure, which is a five-membered heterocyclic compound containing two nitrogen atoms. This substance features a chloromethyl group, which enhances its reactivity, particularly in nucleophilic substitution reactions. The carboxylate functional group contributes to its acidity and potential for forming salts or esters. Typically, compounds like this are of interest in medicinal chemistry and agricultural applications due to their biological activity. The presence of the methyl ester group suggests that it may be involved in various chemical transformations, making it a versatile intermediate in organic synthesis. Additionally, the compound's CAS number, 860807-43-8, allows for precise identification and retrieval of information in chemical databases. Overall, Methyl 1-(chloromethyl)-1H-pyrazole-4-carboxylate is notable for its structural features that facilitate diverse chemical reactivity and potential applications in various fields.
Formula:C6H7ClN2O2
InChI:InChI=1S/C6H7ClN2O2/c1-11-6(10)5-2-8-9(3-5)4-7/h2-3H,4H2,1H3
InChI key:InChIKey=LVDZENHVICIXNT-UHFFFAOYSA-N
SMILES:C(OC)(=O)C1=CN(CCl)N=C1
Synonyms:- Methyl 1-(chloromethyl)-1H-pyrazole-4-carboxylate
- 1H-Pyrazole-4-carboxylic acid, 1-(chloromethyl)-, methyl ester
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.