CAS 860997-09-7
:N-methyl-1-(3-methylthiophen-2-yl)methanamine
Description:
N-methyl-1-(3-methylthiophen-2-yl)methanamine, identified by its CAS number 860997-09-7, is an organic compound characterized by its structure, which includes a methyl group attached to a nitrogen atom and a thiophene ring substituted with a methyl group. This compound is classified as an amine due to the presence of the amine functional group (-NH). The thiophene ring contributes to its aromatic properties, which can influence its reactivity and interactions with other molecules. Typically, compounds like this may exhibit biological activity, making them of interest in pharmaceutical research. The presence of both the methyl group and the thiophene moiety can affect the compound's solubility, stability, and potential applications in various fields, including medicinal chemistry and materials science. As with many organic compounds, its properties such as melting point, boiling point, and solubility would depend on the specific molecular interactions and the environment in which it is studied.
Formula:C7H11NS
InChI:InChI=1/C7H11NS/c1-6-3-4-9-7(6)5-8-2/h3-4,8H,5H2,1-2H3
SMILES:Cc1ccsc1CNC
Synonyms:- 2-thiophenemethanamine, N,3-dimethyl-
- N-Methyl-1-(3-methyl-2-thienyl)methanamine
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 1 products.
