CAS 86100-63-2

2,5-bis[5-[5-(2-thienyl)-2-thienyl]-2-thienyl]thiophene

Description:

2,5-bis[5-[5-(2-thienyl)-2-thienyl]-2-thienyl]thiophene, with CAS number 86100-63-2, is a complex organic compound characterized by its unique structure that incorporates multiple thiophene rings. Thiophenes are five-membered aromatic heterocycles containing sulfur, which contribute to the compound's electronic properties. This substance is known for its potential applications in organic electronics, particularly in organic photovoltaics and field-effect transistors, due to its ability to facilitate charge transport. The presence of multiple thiophene units enhances its conjugation, leading to improved stability and conductivity. Additionally, the compound exhibits interesting optical properties, making it suitable for use in light-emitting devices. Its synthesis typically involves multi-step organic reactions, and it may be characterized using techniques such as NMR spectroscopy, mass spectrometry, and UV-Vis spectroscopy to confirm its structure and purity. Overall, 2,5-bis[5-[5-(2-thienyl)-2-thienyl]-2-thienyl]thiophene represents a significant compound in the field of materials science and organic chemistry.

Formula: C₂₈H₁₆S₇

InChI: InChI=1/C28H16S7/c1-3-17(29-15-1)19-5-7-21(31-19)23-9-11-25(33-23)27-13-14-28(35-27)26-12-10-24(34-26)22-8-6-20(32-22)18-4-2-16-30-18/h1-16H

SMILES: c1cc(c2ccc(c3ccc(c4ccc(c5ccc(c6ccc(c7cccs7)s6)s5)s4)s3)s2)sc1

α-Septithiophene

CAS: 86100-63-2

Formula: C₂₈H₁₆S₇

Color and Shape: Orange to Amber to Dark red powder to crystal

Molecular weight: 576.86

Ref: 3B-S0505

α-Septithiophene ,

CAS: 86100-63-2

Formula: C₂₈H₁₈S₇

Purity: 95%

Color and Shape: Solid

Molecular weight: 578.8975

Ref: IN-DA003NSL