CAS 861009-82-7

[2-(2-methylprop-2-enyl)phenyl] acetate

Description:

[2-(2-methylprop-2-enyl)phenyl] acetate, with the CAS number 861009-82-7, is an organic compound characterized by its ester functional group, which is formed from the reaction of acetic acid and a phenolic compound. This substance features a phenyl ring substituted with a 2-methylprop-2-enyl group, contributing to its unique structural and chemical properties. The presence of the acetate group suggests that it may exhibit moderate polarity, influencing its solubility in various solvents. Additionally, the branched alkene structure can impart reactivity, particularly in polymerization or substitution reactions. The compound may also possess aromatic characteristics, which can affect its stability and interaction with other chemical species. Its potential applications could span various fields, including fragrance, flavoring, or as an intermediate in organic synthesis. However, specific physical properties such as boiling point, melting point, and density would need to be referenced from experimental data or literature for precise applications and handling guidelines.

Formula: C₁₂H₁₄O₂

InChI: InChI=1/C12H14O2/c1-9(2)8-11-6-4-5-7-12(11)14-10(3)13/h4-7H,1,8H2,2-3H3

SMILES: C=C(C)Cc1ccccc1OC(=O)C

3-(2-Acetoxyphenyl)-2-methyl-1-propene

CAS: 861009-82-7

Formula: C₁₂H₁₄O₂

Purity: 97.0%

Molecular weight: 190.242

Ref: 10-F200303