CAS 861030-95-7
:4-Chloro-2,6-dimethyl-5-pyrimidinamine
Description:
4-Chloro-2,6-dimethyl-5-pyrimidinamine is an organic compound characterized by its pyrimidine ring structure, which is a six-membered aromatic ring containing two nitrogen atoms at positions 1 and 3. The presence of a chloro group at the 4-position and two methyl groups at the 2 and 6 positions contributes to its unique chemical properties. This compound is typically a solid at room temperature and may exhibit moderate solubility in polar solvents due to the presence of the amino group, which can engage in hydrogen bonding. Its structure suggests potential applications in pharmaceuticals or agrochemicals, as pyrimidine derivatives are often explored for their biological activity. The compound's reactivity may include nucleophilic substitution reactions due to the chloro substituent, and it may also participate in various coupling reactions typical of amines. Safety data should be consulted for handling, as with any chemical substance, to ensure proper precautions are taken.
Formula:C6H8ClN3
InChI:InChI=1S/C6H8ClN3/c1-3-5(8)6(7)10-4(2)9-3/h8H2,1-2H3
InChI key:InChIKey=CHUOVASMYWLLDE-UHFFFAOYSA-N
SMILES:NC=1C(C)=NC(C)=NC1Cl
Synonyms:- 5-Pyrimidinamine, 4-chloro-2,6-dimethyl-
- Pyrimidine, 5-amino-4-chloro-2,6-dimethyl-
- 4-Chloro-2,6-dimethyl-5-pyrimidinamine
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 1 products.
