CAS 861106-91-4

(2-bromo-6-nitrophenyl)methanol

Description:

(2-Bromo-6-nitrophenyl)methanol is an organic compound characterized by the presence of a bromine atom and a nitro group attached to a phenyl ring, along with a hydroxymethyl group (-CH2OH). This compound typically exhibits a pale yellow to light brown appearance and is soluble in polar solvents due to the hydroxyl group, which can engage in hydrogen bonding. The presence of the bromine and nitro substituents can influence its reactivity, making it a potential candidate for various chemical reactions, including nucleophilic substitutions and electrophilic aromatic substitutions. The nitro group is known to be a strong electron-withdrawing group, which can affect the acidity of the hydroxyl group and the overall electron density of the aromatic ring. Additionally, this compound may exhibit biological activity, making it of interest in medicinal chemistry and material science. Safety precautions should be taken when handling this substance, as it may pose health risks due to its halogen and nitro functionalities.

Formula: C₇H₆BrNO₃

InChI: InChI=1/C7H6BrNO3/c8-6-2-1-3-7(9(11)12)5(6)4-10/h1-3,10H,4H2

SMILES: c1cc(c(CO)c(c1)N(=O)=O)Br

Synonyms:

• (2-BroMo-6-notrophenyl)Methanol

BENZENEMETHANOL, 2-BROMO-6-NITRO-

CAS: 861106-91-4

Formula: C₇H₆BrNO₃

Purity: 97%

Color and Shape: Solid

Molecular weight: 232.0314

Ref: IN-DA004P34

2-Bromo-6-nitrobenzyl alcohol

CAS: 861106-91-4

2-Bromo-6-nitrobenzyl alcohol

Formula: C₇H₆BrNO₃

Purity: 97%

Color and Shape: brown to dark brown solid

Molecular weight: 232.03g/mol

Ref: 54-OR962824

(2-Bromo-6-nitrophenyl)methanol

CAS: 861106-91-4

Formula: C₇H₆BrNO₃

Purity: 95%

Color and Shape: Solid

Molecular weight: 232.033

Ref: 10-F211479