CAS 861106-92-5

2-Amino-6-bromobenzenemethanol

Description:

2-Amino-6-bromobenzenemethanol, with the CAS number 861106-92-5, is an organic compound characterized by the presence of an amino group (-NH2), a bromine atom, and a hydroxymethyl group (-CH2OH) attached to a benzene ring. This compound features a bromine substituent at the 6-position and an amino group at the 2-position of the benzene ring, which influences its reactivity and potential applications in organic synthesis. The hydroxymethyl group enhances its solubility in polar solvents and can participate in various chemical reactions, such as nucleophilic substitutions or coupling reactions. The presence of both the amino and hydroxymethyl groups suggests that this compound may exhibit biological activity, making it of interest in medicinal chemistry. Additionally, the bromine atom can serve as a useful handle for further functionalization, allowing for the synthesis of more complex molecules. Overall, 2-Amino-6-bromobenzenemethanol is a versatile compound with potential applications in pharmaceuticals and materials science.

Formula: C₇H₈BrNO

InChI: InChI=1S/C7H8BrNO/c8-6-2-1-3-7(9)5(6)4-10/h1-3,10H,4,9H2

InChI key: InChIKey=OGWBVTDYXWQJSM-UHFFFAOYSA-N

SMILES: C(O)C1=C(Br)C=CC=C1N

Synonyms:

• (2-Amino-6-bromophenyl)methanol
• 2-Amino-6-bromobenzyl alcohol
• Benzenemethanol, 2-amino-6-bromo-
• 2-Amino-6-bromobenzenemethanol

(2-Amino-6-bromophenyl)methanol

CAS: 861106-92-5

Formula: C₇H₈BrNO

Purity: 98%

Color and Shape: Solid

Molecular weight: 202.0485

Ref: IN-DA00IDWS

(2-Amino-6-bromophenyl)methanol

CAS: 861106-92-5

(2-Amino-6-bromophenyl)methanol

Purity: 98%

Molecular weight: 202.05g/mol

Ref: 54-OR76623

(2-Amino-6-bromophenyl)methanol

CAS: 861106-92-5

Formula: C₇H₈BrNO

Purity: 98%

Molecular weight: 202.051

Ref: 10-F433564

(2-Amino-6-bromophenyl)methanol

CAS: 861106-92-5

Versatile small molecule scaffold

Formula: C₇H₈BrNO

Purity: Min. 95%

Molecular weight: 202.05 g/mol

Ref: 3D-LJB10692