CymitQuimica logo

CAS 861117-99-9

:

4-bromo-3,5-diiodobenzoic acid

Description:
4-Bromo-3,5-diiodobenzoic acid is an aromatic carboxylic acid characterized by the presence of bromine and iodine substituents on a benzene ring. Specifically, it features a bromine atom at the para position (4) and two iodine atoms at the meta positions (3 and 5) relative to the carboxylic acid group (-COOH). This compound is typically a solid at room temperature and may exhibit a crystalline structure. Its molecular structure contributes to its unique chemical properties, including potential applications in organic synthesis and medicinal chemistry. The presence of halogens can influence its reactivity, solubility, and interaction with biological systems. The compound is likely to be sparingly soluble in water but may dissolve in organic solvents. Additionally, due to the presence of multiple halogen atoms, it may exhibit interesting electronic properties, making it a candidate for various chemical reactions, including electrophilic substitutions. Safety precautions should be taken when handling this compound, as halogenated compounds can pose health risks.
Formula:C7H3BrI2O2
InChI:InChI=1/C7H3BrI2O2/c8-6-4(9)1-3(7(11)12)2-5(6)10/h1-2H,(H,11,12)
SMILES:c1c(cc(c(c1I)Br)I)C(=O)O
Sort by

The purity filter is not visible because current products do not have associated purity data for filtering.
Found 1 products.