CAS 861151-23-7

1-(4-Chlorophenyl)-4,5-dihydro-5-phenyl-1H-pyrazole-3-carboxylic acid

Description:

1-(4-Chlorophenyl)-4,5-dihydro-5-phenyl-1H-pyrazole-3-carboxylic acid is a chemical compound characterized by its pyrazole core, which is a five-membered ring containing two nitrogen atoms. The presence of a 4-chlorophenyl group indicates that there is a chlorine substituent on a phenyl ring, contributing to its potential biological activity. The compound also features a carboxylic acid functional group, which can influence its solubility and reactivity. Typically, compounds of this nature may exhibit various pharmacological properties, making them of interest in medicinal chemistry. The dihydro structure suggests that the compound may exist in a specific conformation, which can affect its interactions with biological targets. Additionally, the presence of multiple aromatic systems may enhance its stability and lipophilicity. Overall, this compound's unique structural features suggest potential applications in drug development and research, particularly in areas related to anti-inflammatory or analgesic activities, although specific biological activities would require empirical investigation.

Formula: C₁₆H₁₃ClN₂O₂

InChI: InChI=1S/C16H13ClN2O2/c17-12-6-8-13(9-7-12)19-15(10-14(18-19)16(20)21)11-4-2-1-3-5-11/h1-9,15H,10H2,(H,20,21)

InChI key: InChIKey=MWXCWRZVUVDGSI-UHFFFAOYSA-N

SMILES: C(O)(=O)C1=NN(C(C1)C2=CC=CC=C2)C3=CC=C(Cl)C=C3

Synonyms:

• 1H-Pyrazole-3-carboxylic acid, 1-(4-chlorophenyl)-4,5-dihydro-5-phenyl-
• 1-(4-Chlorophenyl)-5-phenyl-4,5-dihydro-1H-pyrazole-3-carboxylic acid
• 1-(4-Chlorophenyl)-4,5-dihydro-5-phenyl-1H-pyrazole-3-carboxylic acid

1-(4-Chlorophenyl)-5-phenyl-4,5-dihydro-1H-pyrazole-3-carboxylic acid

CAS: 861151-23-7

1-(4-Chlorophenyl)-5-phenyl-4,5-dihydro-1H-pyrazole-3-carboxylic acid

Purity: ≥95%

Molecular weight: 300.74g/mol

Ref: 54-OR111090