CAS 86116-84-9
:2-benzyl-L-proline hydrochloride
Description:
2-benzyl-L-proline hydrochloride is a chemical compound that belongs to the class of proline derivatives, specifically an amino acid derivative. It is characterized by the presence of a benzyl group attached to the proline structure, which contributes to its unique properties. This compound typically appears as a white to off-white crystalline powder and is soluble in water and various organic solvents, making it useful in different chemical applications. The hydrochloride form indicates that it is a salt, which often enhances its stability and solubility. 2-benzyl-L-proline hydrochloride is of interest in medicinal chemistry and pharmaceutical research, particularly for its potential role in the synthesis of bioactive molecules and as a building block in drug development. Its chiral nature, stemming from the proline backbone, allows for the exploration of its enantiomers in biological systems, which can exhibit different pharmacological activities. As with many chemical substances, proper handling and safety precautions are essential due to its potential biological effects.
Formula:C12H16ClNO2
InChI:InChI=1/C12H15NO2.ClH/c14-11(15)12(7-4-8-13-12)9-10-5-2-1-3-6-10;/h1-3,5-6,13H,4,7-9H2,(H,14,15);1H/t12-;/m1./s1
SMILES:c1ccc(cc1)C[C@]1(CCCN1)C(=O)O.Cl
Sort by
Purity (%)
0
100
|
0
|
50
|
90
|
95
|
100
Found 3 products.
2-Benzyl-L-proline hydrochloride, 95%
CAS:This Thermo Scientific Chemicals brand product was originally part of the Alfa Aesar product portfolio. Some documentation and label information may refer to the legacy brand. The original Alfa Aesar product / item code or SKU reference has not changed as a part of the brand transition to Thermo SciFormula:C12H15NO2•HClPurity:95%Molecular weight:241.72(R)-2-Benzylpyrrolidine-2-carboxylic acid
CAS:(R)-2-Benzylpyrrolidine-2-carboxylic acidPurity:97%Molecular weight:205.26g/mol


