CAS 861199-62-4

6-methylpyridine-3,4-diamine

Description:

6-Methylpyridine-3,4-diamine, identified by its CAS number 861199-62-4, is an organic compound belonging to the class of pyridine derivatives. It features a pyridine ring substituted with two amino groups at the 3 and 4 positions and a methyl group at the 6 position. This compound is characterized by its potential as a building block in organic synthesis and its applications in pharmaceuticals and agrochemicals. The presence of amino groups contributes to its basicity and reactivity, allowing it to participate in various chemical reactions, such as nucleophilic substitutions and coupling reactions. Additionally, the methyl group can influence the compound's solubility and steric properties. 6-Methylpyridine-3,4-diamine may exhibit biological activity, making it of interest in medicinal chemistry. As with many nitrogen-containing heterocycles, it may also display unique electronic properties due to the presence of the nitrogen atoms in the aromatic ring. Safety data and handling precautions should be considered, as with any chemical substance, to ensure proper usage and minimize risks.

Formula: C₆H₉N₃

InChI: InChI=1/C6H9N3/c1-4-2-5(7)6(8)3-9-4/h2-3H,8H2,1H3,(H2,7,9)

SMILES: Cc1cc(=N)c(c[nH]1)N

Synonyms:

• 3,4-Pyridinediamine, 6-Methyl-

6-Methylpyridine-3,4-Diamine

CAS: 861199-62-4

Formula: C₆H₉N₃

Color and Shape: Solid

Molecular weight: 123.1558

Ref: IN-DA004TX5

6-Methylpyridine-3,4-diamine

CAS: 861199-62-4

Formula: C₆H₉N₃

Purity: 95.0%

Molecular weight: 123.159

Ref: 10-F219984

6-Methylpyridine-3,4-diamine

CAS: 861199-62-4

Versatile small molecule scaffold

Formula: C₆H₉N₃

Purity: Min. 95%

Molecular weight: 123.16 g/mol

Ref: 3D-LJB19962