CAS 86120-58-3
:5,5-difluoropentane-1,4-diamine
Description:
5,5-Difluoropentane-1,4-diamine, with the CAS number 86120-58-3, is an organic compound characterized by the presence of two amino groups (-NH2) and two fluorine atoms attached to a five-carbon alkane chain. This compound features a linear structure, where the amino groups are located at the terminal positions of the pentane chain, specifically at the first and fourth carbon atoms. The presence of fluorine atoms significantly influences its chemical properties, including increased polarity and potential reactivity, which can affect its solubility in various solvents. The compound may exhibit basic properties due to the amino groups, allowing it to participate in various chemical reactions, such as nucleophilic substitutions. Additionally, the fluorine substituents can enhance the compound's stability and alter its interaction with biological systems, making it of interest in medicinal chemistry and materials science. Safety and handling precautions should be observed, as with many amines and fluorinated compounds, due to potential toxicity and reactivity.
Formula:C5H12F2N2
InChI:InChI=1/C5H12F2N2/c6-5(7)4(9)2-1-3-8/h4-5H,1-3,8-9H2
SMILES:C(CC(C(F)F)N)CN
Synonyms:- 1,4-Pentanediamine, 5,5-Difluoro-
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.