
CAS 861207-05-8
:7-(4-Fluorophenyl)-6-[2-(4-morpholinyl)ethyl]pyrido[2,3-d]pyrimidine-2,4-diamine
Description:
7-(4-Fluorophenyl)-6-[2-(4-morpholinyl)ethyl]pyrido[2,3-d]pyrimidine-2,4-diamine, with CAS number 861207-05-8, is a synthetic organic compound characterized by its complex heterocyclic structure. This compound features a pyrido[2,3-d]pyrimidine core, which is a bicyclic structure that incorporates nitrogen atoms, contributing to its potential biological activity. The presence of a 4-fluorophenyl group enhances its lipophilicity and may influence its interaction with biological targets. Additionally, the 4-morpholinyl ethyl substituent introduces a flexible side chain that can facilitate binding to specific receptors or enzymes. This compound is of interest in medicinal chemistry, particularly for its potential applications in drug development, possibly targeting various diseases. Its properties, such as solubility, stability, and reactivity, can be influenced by the functional groups present, making it a candidate for further pharmacological studies. As with many compounds in this class, understanding its mechanism of action and biological effects would require comprehensive experimental evaluation.
Formula:C19H21FN6O
InChI:InChI=1S/C19H21FN6O/c20-14-3-1-12(2-4-14)16-13(5-6-26-7-9-27-10-8-26)11-15-17(21)24-19(22)25-18(15)23-16/h1-4,11H,5-10H2,(H4,21,22,23,24,25)
InChI key:InChIKey=RPVYHEBHYIFLNM-UHFFFAOYSA-N
SMILES:C(CN1CCOCC1)C=2C(=NC3=C(C2)C(N)=NC(N)=N3)C4=CC=C(F)C=C4
Synonyms:- Pyrido[2,3-d]pyrimidine-2,4-diamine, 7-(4-fluorophenyl)-6-[2-(4-morpholinyl)ethyl]-
- 7-(4-Fluorophenyl)-6-[2-(4-morpholinyl)ethyl]pyrido[2,3-d]pyrimidine-2,4-diamine
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.