
CAS 861207-15-0
:1-[3-(1,3-Dihydro-2H-isoindol-2-yl)phenyl]ethanone O-[(2,6-dichlorophenyl)methyl]oxime
Description:
1-[3-(1,3-Dihydro-2H-isoindol-2-yl)phenyl]ethanone O-[(2,6-dichlorophenyl)methyl]oxime, with CAS number 861207-15-0, is a synthetic organic compound characterized by its complex structure, which includes an isoindole moiety and an oxime functional group. This compound typically exhibits properties associated with both aromatic and aliphatic systems, contributing to its potential reactivity and biological activity. The presence of the dichlorophenyl group suggests enhanced lipophilicity, which may influence its solubility and interaction with biological targets. The oxime functional group can participate in various chemical reactions, including nucleophilic additions and rearrangements. Additionally, compounds of this nature may exhibit pharmacological properties, making them of interest in medicinal chemistry. The specific characteristics, such as melting point, boiling point, and spectral data, would require empirical determination or literature reference for precise values. Overall, this compound represents a class of organic molecules that may have applications in drug development or as intermediates in organic synthesis.
Formula:C23H20Cl2N2O
InChI:InChI=1S/C23H20Cl2N2O/c1-16(26-28-15-21-22(24)10-5-11-23(21)25)17-8-4-9-20(12-17)27-13-18-6-2-3-7-19(18)14-27/h2-12H,13-15H2,1H3
InChI key:InChIKey=ROHKZLGVFRPRIG-UHFFFAOYSA-N
SMILES:C(=NOCC1=C(Cl)C=CC=C1Cl)(C)C=2C=C(N3CC=4C(C3)=CC=CC4)C=CC2
Synonyms:- 1-[3-(1,3-Dihydro-2H-isoindol-2-yl)phenyl]ethanone O-[(2,6-dichlorophenyl)methyl]oxime
- Ethanone, 1-[3-(1,3-dihydro-2H-isoindol-2-yl)phenyl]-, O-[(2,6-dichlorophenyl)methyl]oxime
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.