
CAS 861207-29-6
:1-[3-(1,3-Dihydro-2H-isoindol-2-yl)phenyl]ethanone O-[(2-bromophenyl)methyl]oxime
Description:
1-[3-(1,3-Dihydro-2H-isoindol-2-yl)phenyl]ethanone O-[(2-bromophenyl)methyl]oxime, with CAS number 861207-29-6, is a synthetic organic compound characterized by its complex molecular structure, which includes an isoindole moiety and an oxime functional group. This compound typically exhibits properties associated with both aromatic and aliphatic systems, contributing to its potential reactivity and stability. The presence of the bromophenyl group may enhance its lipophilicity and influence its biological activity. As an oxime, it may participate in various chemical reactions, including condensation and rearrangement, making it of interest in medicinal chemistry and material science. Its unique structure suggests potential applications in drug development, particularly in targeting specific biological pathways or as a precursor for further chemical modifications. However, detailed studies on its physical properties, such as solubility, melting point, and spectral characteristics, would be necessary to fully understand its behavior in different environments and its potential uses in various fields.
Formula:C23H21BrN2O
InChI:InChI=1S/C23H21BrN2O/c1-17(25-27-16-21-9-4-5-12-23(21)24)18-10-6-11-22(13-18)26-14-19-7-2-3-8-20(19)15-26/h2-13H,14-16H2,1H3
InChI key:InChIKey=SOYAVTBHDKDLRE-UHFFFAOYSA-N
SMILES:C(=NOCC1=C(Br)C=CC=C1)(C)C=2C=C(N3CC=4C(C3)=CC=CC4)C=CC2
Synonyms:- 1-[3-(1,3-Dihydro-2H-isoindol-2-yl)phenyl]ethanone O-[(2-bromophenyl)methyl]oxime
- Ethanone, 1-[3-(1,3-dihydro-2H-isoindol-2-yl)phenyl]-, O-[(2-bromophenyl)methyl]oxime
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.