
CAS 861207-78-5
:4-Methylbenzoic acid 2-[(3-chloro-4-methoxyphenyl)methylene]hydrazide
Description:
4-Methylbenzoic acid 2-[(3-chloro-4-methoxyphenyl)methylene]hydrazide, identified by its CAS number 861207-78-5, is a chemical compound characterized by its hydrazide functional group, which is derived from the reaction of 4-methylbenzoic acid and a substituted phenyl hydrazine. This compound typically exhibits properties associated with both hydrazides and aromatic compounds, including moderate solubility in organic solvents and potential reactivity due to the presence of the hydrazide moiety. The presence of the chloro and methoxy substituents on the phenyl ring can influence its electronic properties and reactivity, making it of interest in various chemical applications, including potential pharmaceutical uses. The compound may also exhibit biological activity, which is often explored in medicinal chemistry. Its structural features suggest it could participate in hydrogen bonding and other intermolecular interactions, impacting its physical properties such as melting point and boiling point. Overall, 4-Methylbenzoic acid 2-[(3-chloro-4-methoxyphenyl)methylene]hydrazide represents a complex organic molecule with diverse potential applications.
Formula:C16H15ClN2O2
InChI:InChI=1S/C16H15ClN2O2/c1-11-3-6-13(7-4-11)16(20)19-18-10-12-5-8-15(21-2)14(17)9-12/h3-10H,1-2H3,(H,19,20)
InChI key:InChIKey=MJOXGHGEGDITLV-UHFFFAOYSA-N
SMILES:C(NN=CC1=CC(Cl)=C(OC)C=C1)(=O)C2=CC=C(C)C=C2
Synonyms:- 4-Methylbenzoic acid 2-[(3-chloro-4-methoxyphenyl)methylene]hydrazide
- Benzoic acid, 4-methyl-, 2-[(3-chloro-4-methoxyphenyl)methylene]hydrazide
- Benzoic acid, 4-methyl-, [(3-chloro-4-methoxyphenyl)methylene]hydrazide
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.