
CAS 861208-65-3
:Propyl N-[2-(4-chlorophenyl)-4-quinolinyl]carbamate
Description:
Propyl N-[2-(4-chlorophenyl)-4-quinolinyl]carbamate, identified by its CAS number 861208-65-3, is a chemical compound that belongs to the class of carbamates. This substance features a propyl group attached to a carbamate functional group, which is further linked to a quinoline moiety substituted with a 4-chlorophenyl group. The presence of the chlorophenyl group suggests potential biological activity, as halogenated aromatic compounds often exhibit interesting pharmacological properties. The quinoline structure is known for its role in various medicinal applications, including antimalarial and antimicrobial activities. The compound's solubility, stability, and reactivity can be influenced by the functional groups present, making it a subject of interest in medicinal chemistry and drug development. Additionally, the specific arrangement of atoms and the presence of the chlorine atom can affect the compound's interactions with biological targets, potentially leading to therapeutic applications. However, detailed studies would be necessary to fully elucidate its properties and potential uses.
Formula:C19H17ClN2O2
InChI:InChI=1S/C19H17ClN2O2/c1-2-11-24-19(23)22-18-12-17(13-7-9-14(20)10-8-13)21-16-6-4-3-5-15(16)18/h3-10,12H,2,11H2,1H3,(H,21,22,23)
InChI key:InChIKey=BDZXEOZROYOOQO-UHFFFAOYSA-N
SMILES:N(C(OCCC)=O)C=1C2=C(N=C(C1)C3=CC=C(Cl)C=C3)C=CC=C2
Synonyms:- Propyl N-[2-(4-chlorophenyl)-4-quinolinyl]carbamate
- Carbamic acid, N-[2-(4-chlorophenyl)-4-quinolinyl]-, propyl ester
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.