
CAS 861209-46-3
:β-[(2,2,2-Trifluoroacetyl)amino]-2-thiophenepropanamide
Description:
β-[(2,2,2-Trifluoroacetyl)amino]-2-thiophenepropanamide, with the CAS number 861209-46-3, is a synthetic organic compound characterized by its unique structural features, including a thiophene ring and a trifluoroacetyl group. This compound typically exhibits properties associated with both amides and heterocyclic compounds, such as moderate solubility in polar solvents and potential reactivity due to the presence of the trifluoroacetyl moiety, which can influence its chemical behavior and interactions. The thiophene ring contributes to its aromatic character, potentially enhancing stability and influencing electronic properties. Additionally, the presence of fluorine atoms in the trifluoroacetyl group can impart distinctive characteristics, such as increased lipophilicity and altered biological activity. This compound may be of interest in pharmaceutical research and development due to its potential applications in medicinal chemistry, particularly in the design of novel therapeutic agents. Overall, its unique combination of functional groups and structural features makes it a subject of interest in various chemical and biological studies.
Formula:C9H9F3N2O2S
InChI:InChI=1S/C9H9F3N2O2S/c10-9(11,12)8(16)14-5(4-7(13)15)6-2-1-3-17-6/h1-3,5H,4H2,(H2,13,15)(H,14,16)
InChI key:InChIKey=DXLKVTSMCIQFCT-UHFFFAOYSA-N
SMILES:C(NC(C(F)(F)F)=O)(CC(N)=O)C1=CC=CS1
Synonyms:- 2-Thiophenepropanamide, β-[(trifluoroacetyl)amino]-
- 2-Thiophenepropanamide, β-[(2,2,2-trifluoroacetyl)amino]-
- β-[(2,2,2-Trifluoroacetyl)amino]-2-thiophenepropanamide
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.