CymitQuimica logo

CAS 861209-51-0

:

N-[2,3-Dihydro-3-(hydroxyimino)-5,6-dimethoxy-1H-inden-1-yl]-2,2,2-trifluoroacetamide

Description:
N-[2,3-Dihydro-3-(hydroxyimino)-5,6-dimethoxy-1H-inden-1-yl]-2,2,2-trifluoroacetamide is a chemical compound characterized by its complex structure, which includes an indene core substituted with methoxy groups and a hydroxyimino functional group. The presence of the trifluoroacetamide moiety contributes to its unique chemical properties, including increased lipophilicity and potential biological activity. This compound may exhibit interesting pharmacological properties, making it a subject of interest in medicinal chemistry. Its molecular structure suggests potential interactions with biological targets, possibly influencing enzyme activity or receptor binding. The trifluoroacetamide group can enhance stability and solubility in various solvents, which is advantageous for formulation in pharmaceutical applications. Additionally, the presence of multiple functional groups allows for diverse reactivity, making it a versatile compound for further chemical modifications. Overall, this substance represents a unique intersection of organic chemistry and potential therapeutic applications, warranting further investigation into its properties and uses.
Formula:C13H13F3N2O4
InChI:InChI=1S/C13H13F3N2O4/c1-21-10-3-6-7(4-11(10)22-2)9(18-20)5-8(6)17-12(19)13(14,15)16/h3-4,8,20H,5H2,1-2H3,(H,17,19)
InChI key:InChIKey=NPXXPZOFKWAMQL-UHFFFAOYSA-N
SMILES:N(C(C(F)(F)F)=O)C1C=2C(C(=NO)C1)=CC(OC)=C(OC)C2
Synonyms:
  • Acetamide, N-[2,3-dihydro-3-(hydroxyimino)-5,6-dimethoxy-1H-inden-1-yl]-2,2,2-trifluoro-
  • N-[2,3-Dihydro-3-(hydroxyimino)-5,6-dimethoxy-1H-inden-1-yl]-2,2,2-trifluoroacetamide
Sort by

The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.