
CAS 861209-78-1
:3-Chloro-N-[3-(1-hexyn-1-yl)phenyl]benzamide
Description:
3-Chloro-N-[3-(1-hexyn-1-yl)phenyl]benzamide, with the CAS number 861209-78-1, is an organic compound characterized by its complex structure, which includes a benzamide core substituted with a chloro group and a phenyl moiety linked to a hexynyl chain. This compound typically exhibits properties associated with aromatic amides, such as moderate solubility in organic solvents and potential reactivity due to the presence of the chloro substituent. The hexynyl group introduces a degree of unsaturation, which can influence its reactivity and interactions with other molecules. The presence of both aromatic and aliphatic components suggests that it may participate in various chemical reactions, including nucleophilic substitutions and coupling reactions. Additionally, the compound may exhibit biological activity, making it of interest in medicinal chemistry and drug development. Its specific characteristics, such as melting point, boiling point, and spectral data, would require empirical measurement or literature reference for precise values.
Formula:C19H18ClNO
InChI:InChI=1S/C19H18ClNO/c1-2-3-4-5-8-15-9-6-12-18(13-15)21-19(22)16-10-7-11-17(20)14-16/h6-7,9-14H,2-4H2,1H3,(H,21,22)
InChI key:InChIKey=HNIYJIYURRPDIK-UHFFFAOYSA-N
SMILES:C(NC1=CC(C#CCCCC)=CC=C1)(=O)C2=CC(Cl)=CC=C2
Synonyms:- Benzamide, 3-chloro-N-[3-(1-hexyn-1-yl)phenyl]-
- Benzamide, 3-chloro-N-[3-(1-hexynyl)phenyl]-
- 3-Chloro-N-[3-(1-hexyn-1-yl)phenyl]benzamide
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.