
CAS 861209-92-9
:2-Chloro-5-[2-(2-nitrophenyl)ethyl]thiazole
Description:
2-Chloro-5-[2-(2-nitrophenyl)ethyl]thiazole is a chemical compound characterized by its thiazole ring, which is a five-membered heterocyclic structure containing both sulfur and nitrogen. The presence of a chlorine atom at the 2-position and a 2-(2-nitrophenyl)ethyl group at the 5-position contributes to its unique reactivity and potential applications. This compound is typically a solid at room temperature and may exhibit moderate solubility in organic solvents, depending on the specific conditions. Its nitrophenyl substituent suggests potential for biological activity, making it of interest in medicinal chemistry and drug development. The thiazole moiety is known for its role in various pharmacological activities, including antimicrobial and anti-inflammatory properties. Safety data should be consulted for handling, as the presence of chlorine and nitro groups can indicate potential toxicity or environmental hazards. Overall, 2-Chloro-5-[2-(2-nitrophenyl)ethyl]thiazole represents a compound with diverse chemical properties and potential applications in research and industry.
Formula:C11H9ClN2O2S
InChI:InChI=1S/C11H9ClN2O2S/c12-11-13-7-9(17-11)6-5-8-3-1-2-4-10(8)14(15)16/h1-4,7H,5-6H2
InChI key:InChIKey=FAENDJJQRXQEGC-UHFFFAOYSA-N
SMILES:C(CC=1SC(Cl)=NC1)C2=C(N(=O)=O)C=CC=C2
Synonyms:- Thiazole, 2-chloro-5-[2-(2-nitrophenyl)ethyl]-
- 2-Chloro-5-[2-(2-nitrophenyl)ethyl]thiazole
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.