CAS 861210-09-5

1-[4-(Aminomethyl)phenyl]-4-piperidinemethanol

Description:

1-[4-(Aminomethyl)phenyl]-4-piperidinemethanol, identified by its CAS number 861210-09-5, is a chemical compound characterized by its complex structure that includes both aromatic and aliphatic components. It features a piperidine ring, which is a six-membered nitrogen-containing heterocycle, and an aminomethyl group attached to a phenyl ring, contributing to its potential biological activity. The presence of a hydroxymethyl group indicates that it can participate in hydrogen bonding, which may influence its solubility and reactivity. This compound is of interest in medicinal chemistry, particularly for its potential applications in drug development, as it may exhibit properties relevant to neurotransmitter modulation or other pharmacological effects. Its molecular structure suggests that it could interact with various biological targets, making it a candidate for further research in therapeutic contexts. As with many organic compounds, its stability, solubility, and reactivity will depend on environmental conditions such as pH and temperature.

Formula: C₁₃H₂₀N₂O

InChI: InChI=1S/C13H20N2O/c14-9-11-1-3-13(4-2-11)15-7-5-12(10-16)6-8-15/h1-4,12,16H,5-10,14H2

InChI key: InChIKey=PVMCVZYYRXYSKG-UHFFFAOYSA-N

SMILES: C(N)C1=CC=C(C=C1)N2CCC(CO)CC2

Synonyms:

• 1-[4-(Aminomethyl)phenyl]-4-piperidinemethanol
• 4-Piperidinemethanol, 1-[4-(aminomethyl)phenyl]-
• [1-[4-(Aminomethyl)phenyl]piperidin-4-yl]methanol

{1-[4-(Aminomethyl)phenyl]piperidin-4-yl}methanol

CAS: 861210-09-5

{1-[4-(Aminomethyl)phenyl]piperidin-4-yl}methanol

Purity: 95%

Molecular weight: 220.31g/mol

Ref: 54-OR32579

{1-[4-(Aminomethyl)phenyl]piperidin-4-yl}methanol

CAS: 861210-09-5

Versatile small molecule scaffold

Formula: C₁₃H₂₀N₂O

Purity: Min. 95%

Molecular weight: 220.31 g/mol

Ref: 3D-LJB21009