CymitQuimica logo

CAS 861210-10-8

:

1,2-Dihydro-4-(2-hydroxyethyl)-5-methyl-2-phenyl-3H-pyrazol-3-one

Description:
1,2-Dihydro-4-(2-hydroxyethyl)-5-methyl-2-phenyl-3H-pyrazol-3-one, with the CAS number 861210-10-8, is a chemical compound characterized by its pyrazolone structure, which features a five-membered ring containing two nitrogen atoms. This compound typically exhibits a range of functional groups, including a hydroxyl group and an ethyl substituent, which can influence its solubility and reactivity. It is likely to be a solid at room temperature and may display moderate stability under standard conditions. The presence of the phenyl and methyl groups contributes to its hydrophobic characteristics, while the hydroxyl group enhances its potential for hydrogen bonding. This compound may have applications in pharmaceuticals or as a chemical intermediate, given its structural features that can be modified for various chemical reactions. Additionally, its unique structure may impart specific biological activities, making it of interest in medicinal chemistry. However, detailed studies would be necessary to fully understand its properties and potential uses.
Formula:C12H14N2O2
InChI:InChI=1S/C12H14N2O2/c1-9-11(7-8-15)12(16)14(13-9)10-5-3-2-4-6-10/h2-6,13,15H,7-8H2,1H3
InChI key:InChIKey=JQICUSPEMWKTSQ-UHFFFAOYSA-N
SMILES:O=C1N(NC(C)=C1CCO)C2=CC=CC=C2
Synonyms:
  • 3H-Pyrazol-3-one, 1,2-dihydro-4-(2-hydroxyethyl)-5-methyl-2-phenyl-
  • 1,2-Dihydro-4-(2-hydroxyethyl)-5-methyl-2-phenyl-3H-pyrazol-3-one
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 2 products.