
CAS 861210-23-3
:2-[(4-Methylphenyl)sulfonyl]-3-[3-(2-pyrimidinyloxy)phenyl]-2-propenenitrile
Description:
2-[(4-Methylphenyl)sulfonyl]-3-[3-(2-pyrimidinyloxy)phenyl]-2-propenenitrile, with the CAS number 861210-23-3, is a synthetic organic compound characterized by its complex structure, which includes a propenenitrile moiety, a sulfonyl group, and a pyrimidinyloxy phenyl group. This compound typically exhibits properties such as moderate to high solubility in organic solvents, which is common for many sulfonyl-containing compounds. It may display biological activity, potentially acting as a pharmaceutical agent or a chemical probe in research settings. The presence of the pyrimidine ring suggests potential interactions with biological targets, possibly influencing enzyme activity or receptor binding. Additionally, the sulfonyl group can enhance the compound's stability and reactivity, making it suitable for various chemical reactions. Overall, this compound's unique structural features contribute to its potential applications in medicinal chemistry and material science. However, specific physical and chemical properties such as melting point, boiling point, and spectral data would require experimental determination or literature reference for precise characterization.
Formula:C20H15N3O3S
InChI:InChI=1S/C20H15N3O3S/c1-15-6-8-18(9-7-15)27(24,25)19(14-21)13-16-4-2-5-17(12-16)26-20-22-10-3-11-23-20/h2-13H,1H3
InChI key:InChIKey=UXSSMDLVNZWBLL-UHFFFAOYSA-N
SMILES:S(C(=CC1=CC(OC=2N=CC=CN2)=CC=C1)C#N)(=O)(=O)C3=CC=C(C)C=C3
Synonyms:- 2-[(4-Methylphenyl)sulfonyl]-3-[3-(2-pyrimidinyloxy)phenyl]-2-propenenitrile
- 2-Propenenitrile, 2-[(4-methylphenyl)sulfonyl]-3-[3-(2-pyrimidinyloxy)phenyl]-
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.