CAS 861210-50-6

6,7-Dimethyl 8-methyl-1,3-dioxolo[4,5-g]quinoline-6,7-dicarboxylate

Description:

6,7-Dimethyl 8-methyl-1,3-dioxolo[4,5-g]quinoline-6,7-dicarboxylate is a complex organic compound characterized by its unique quinoline structure, which includes a dioxole moiety and multiple methyl and carboxylate functional groups. This compound typically exhibits a range of chemical properties, including solubility in organic solvents, which may vary depending on the specific solvent and conditions. The presence of the dicarboxylate groups suggests potential for reactivity in esterification or amidation reactions, making it useful in synthetic organic chemistry. Additionally, the quinoline framework may impart biological activity, as many quinoline derivatives are known for their pharmacological properties. The compound's molecular structure contributes to its stability and potential applications in fields such as medicinal chemistry, materials science, and organic synthesis. However, specific reactivity, stability, and biological activity would require further investigation through empirical studies and characterization techniques.

Formula: C₁₅H₁₃NO₆

InChI: InChI=1S/C15H13NO6/c1-7-8-4-10-11(22-6-21-10)5-9(8)16-13(15(18)20-3)12(7)14(17)19-2/h4-5H,6H2,1-3H3

InChI key: InChIKey=SEPOIZPFDPBGHN-UHFFFAOYSA-N

SMILES: CC1=C2C(=NC(C(OC)=O)=C1C(OC)=O)C=C3C(=C2)OCO3

Synonyms:

• 1,3-Dioxolo[4,5-g]quinoline-6,7-dicarboxylic acid, 8-methyl-, 6,7-dimethyl ester
• 1,3-Dioxolo[4,5-g]quinoline-6,7-dicarboxylic acid, 8-methyl-, dimethyl ester
• 6,7-Dimethyl 8-methyl-1,3-dioxolo[4,5-g]quinoline-6,7-dicarboxylate