CAS 861210-75-5

3-[(2-Methylphenyl)sulfonyl]-2-quinolinamine

Description:

3-[(2-Methylphenyl)sulfonyl]-2-quinolinamine is an organic compound characterized by its unique structural features, which include a quinoline core and a sulfonamide functional group. The presence of the 2-methylphenyl group contributes to its hydrophobic characteristics, while the sulfonyl group enhances its potential for hydrogen bonding and solubility in polar solvents. This compound may exhibit biological activity, making it of interest in medicinal chemistry, particularly in the development of pharmaceuticals. Its molecular structure suggests potential interactions with biological targets, which could be explored for therapeutic applications. Additionally, the compound's stability and reactivity can be influenced by the electronic effects of the substituents on the quinoline ring. As with many sulfonamides, it may also exhibit properties such as antibacterial activity, although specific biological effects would require empirical investigation. Overall, 3-[(2-Methylphenyl)sulfonyl]-2-quinolinamine represents a class of compounds that bridge organic chemistry and pharmacology, warranting further study for its potential applications.

Formula: C₁₆H₁₄N₂O₂S

InChI: InChI=1S/C16H14N2O2S/c1-11-6-2-5-9-14(11)21(19,20)15-10-12-7-3-4-8-13(12)18-16(15)17/h2-10H,1H3,(H2,17,18)

InChI key: InChIKey=SUGVOZHONFQERG-UHFFFAOYSA-N

SMILES: S(=O)(=O)(C1=CC2=C(N=C1N)C=CC=C2)C3=C(C)C=CC=C3

Synonyms:

• 2-Quinolinamine, 3-[(2-methylphenyl)sulfonyl]-
• 3-[(2-Methylphenyl)sulfonyl]-2-quinolinamine