
CAS 861211-48-5
:2-Chloro-5-[(4-methyl-1-piperidinyl)methyl]pyridine
Description:
2-Chloro-5-[(4-methyl-1-piperidinyl)methyl]pyridine, with the CAS number 861211-48-5, is a chemical compound characterized by its pyridine ring structure, which is a six-membered aromatic ring containing one nitrogen atom. This compound features a chlorine substituent at the 2-position and a piperidine moiety at the 5-position, specifically a 4-methyl-1-piperidinyl group linked via a methylene bridge. The presence of the chlorine atom contributes to its reactivity and potential applications in medicinal chemistry, particularly in the development of pharmaceuticals. The piperidine ring enhances its biological activity, often influencing its interaction with biological targets. This compound is typically a solid at room temperature and may exhibit moderate solubility in organic solvents. Its properties, such as melting point, boiling point, and specific reactivity, can vary based on the purity and specific conditions of use. Overall, 2-Chloro-5-[(4-methyl-1-piperidinyl)methyl]pyridine is of interest in various fields, including drug discovery and chemical synthesis.
Formula:C12H17ClN2
InChI:InChI=1S/C12H17ClN2/c1-10-4-6-15(7-5-10)9-11-2-3-12(13)14-8-11/h2-3,8,10H,4-7,9H2,1H3
InChI key:InChIKey=MFBCVFBIYRUABV-UHFFFAOYSA-N
SMILES:C(C=1C=CC(Cl)=NC1)N2CCC(C)CC2
Synonyms:- 2-Chloro-5-[(4-methyl-1-piperidinyl)methyl]pyridine
- Pyridine, 2-chloro-5-[(4-methyl-1-piperidinyl)methyl]-
- 1-(2-Chloropyridin-5-ylmethyl)-4-methylpiperidine
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.