
CAS 861211-54-3
:1-[(6-Chloro-3-pyridinyl)methyl]-4-(2-pyridinyl)piperazine
Description:
1-[(6-Chloro-3-pyridinyl)methyl]-4-(2-pyridinyl)piperazine, identified by its CAS number 861211-54-3, is a chemical compound that belongs to the class of piperazine derivatives. This substance features a piperazine core, which is a six-membered ring containing two nitrogen atoms, and is substituted with pyridine rings that contribute to its pharmacological properties. The presence of the chloro group enhances its lipophilicity and may influence its biological activity. This compound is often studied for its potential applications in medicinal chemistry, particularly in the development of pharmaceuticals targeting various neurological and psychiatric disorders. Its structural characteristics suggest that it may interact with specific receptors in the central nervous system, making it a candidate for further research in drug development. Additionally, the compound's solubility, stability, and reactivity are influenced by the functional groups present, which are critical for its efficacy and safety profile in therapeutic contexts.
Formula:C15H17ClN4
InChI:InChI=1S/C15H17ClN4/c16-14-5-4-13(11-18-14)12-19-7-9-20(10-8-19)15-3-1-2-6-17-15/h1-6,11H,7-10,12H2
InChI key:InChIKey=IWMSXWCTNJUYHZ-UHFFFAOYSA-N
SMILES:C(N1CCN(CC1)C2=CC=CC=N2)C=3C=CC(Cl)=NC3
Synonyms:- 1-[(6-Chloro-3-pyridinyl)methyl]-4-(2-pyridinyl)piperazine
- Piperazine, 1-[(6-chloro-3-pyridinyl)methyl]-4-(2-pyridinyl)-
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.