
CAS 861211-59-8
:1-Methyl-4-[4-(phenylmethyl)-1-piperidinyl]-1H-pyrazolo[3,4-d]pyrimidine
Description:
1-Methyl-4-[4-(phenylmethyl)-1-piperidinyl]-1H-pyrazolo[3,4-d]pyrimidine, with CAS number 861211-59-8, is a synthetic organic compound characterized by its complex heterocyclic structure. This compound features a pyrazolo[3,4-d]pyrimidine core, which is fused with a piperidine ring and a phenylmethyl substituent. It is typically classified as a small molecule and may exhibit pharmacological properties, potentially acting as a modulator of various biological pathways. The presence of the piperidine moiety suggests possible interactions with neurotransmitter systems, making it of interest in medicinal chemistry, particularly in the development of therapeutic agents. The compound's solubility, stability, and reactivity can vary based on its functional groups and overall structure, influencing its behavior in biological systems and its potential applications in drug discovery. As with many synthetic compounds, safety and handling precautions are essential, and its biological activity would require thorough investigation through experimental studies.
Formula:C18H21N5
InChI:InChI=1S/C18H21N5/c1-22-17-16(12-21-22)18(20-13-19-17)23-9-7-15(8-10-23)11-14-5-3-2-4-6-14/h2-6,12-13,15H,7-11H2,1H3
InChI key:InChIKey=HNDXZWKMORMHRA-UHFFFAOYSA-N
SMILES:CN1C=2C(=C(N=CN2)N3CCC(CC4=CC=CC=C4)CC3)C=N1
Synonyms:- 1H-Pyrazolo[3,4-d]pyrimidine, 1-methyl-4-[4-(phenylmethyl)-1-piperidinyl]-
- 1-Methyl-4-[4-(phenylmethyl)-1-piperidinyl]-1H-pyrazolo[3,4-d]pyrimidine
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.