CymitQuimica logo

CAS 861211-64-5

:

3,4-Dihydro-2-methyl-3-oxo-N-(phenylmethyl)-2H-1,4-benzoxazine-2-carboxamide

Description:
3,4-Dihydro-2-methyl-3-oxo-N-(phenylmethyl)-2H-1,4-benzoxazine-2-carboxamide is a synthetic organic compound characterized by its complex structure, which includes a benzoxazine ring, a carboxamide functional group, and a phenylmethyl substituent. This compound typically exhibits properties such as moderate solubility in organic solvents and potential bioactivity, which may include antimicrobial or anticancer effects, although specific biological activities can vary. The presence of the benzoxazine moiety suggests that it may participate in various chemical reactions, including polymerization, making it of interest in materials science. Its molecular structure allows for potential interactions with biological targets, which could be explored in medicinal chemistry. The compound's stability, reactivity, and potential applications in pharmaceuticals or materials depend on its specific functional groups and overall molecular conformation. As with many synthetic compounds, safety and handling precautions should be observed, particularly in laboratory settings.
Formula:C17H16N2O3
InChI:InChI=1S/C17H16N2O3/c1-17(15(20)18-11-12-7-3-2-4-8-12)16(21)19-13-9-5-6-10-14(13)22-17/h2-10H,11H2,1H3,(H,18,20)(H,19,21)
InChI key:InChIKey=NUKOZFZUUFWWMA-UHFFFAOYSA-N
SMILES:C(NCC1=CC=CC=C1)(=O)C2(C)OC=3C(NC2=O)=CC=CC3
Synonyms:
  • 3,4-Dihydro-2-methyl-3-oxo-N-(phenylmethyl)-2H-1,4-benzoxazine-2-carboxamide
  • 2H-1,4-Benzoxazine-2-carboxamide, 3,4-dihydro-2-methyl-3-oxo-N-(phenylmethyl)-
Sort by

The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.