CAS 861212-39-7

6-Methyl-2-phenyl-3-(4-thiomorpholinylmethyl)imidazo[1,2-a]pyridine

Description:

6-Methyl-2-phenyl-3-(4-thiomorpholinylmethyl)imidazo[1,2-a]pyridine is a chemical compound characterized by its complex structure, which includes an imidazo[1,2-a]pyridine core, a methyl group, a phenyl group, and a thiomorpholine moiety. This compound typically exhibits properties such as moderate to high solubility in organic solvents, depending on the specific functional groups present. It may demonstrate biological activity, potentially acting as a pharmacophore in medicinal chemistry, particularly in the development of therapeutic agents. The presence of the thiomorpholine ring can influence its interaction with biological targets, possibly enhancing its efficacy or selectivity. Additionally, the compound's molecular structure suggests it may participate in various chemical reactions, including nucleophilic substitutions or electrophilic additions, due to the reactivity of the imidazole and pyridine rings. As with many organic compounds, its stability, reactivity, and potential applications can be influenced by environmental factors such as pH and temperature. Overall, this compound represents a class of heterocyclic compounds that are of interest in both synthetic and medicinal chemistry.

Formula: C₁₉H₂₁N₃S

InChI: InChI=1S/C19H21N3S/c1-15-7-8-18-20-19(16-5-3-2-4-6-16)17(22(18)13-15)14-21-9-11-23-12-10-21/h2-8,13H,9-12,14H2,1H3

InChI key: InChIKey=XOSJREHQEMLOML-UHFFFAOYSA-N

SMILES: C(C1=C(N=C2N1C=C(C)C=C2)C3=CC=CC=C3)N4CCSCC4

Synonyms:

• Imidazo[1,2-a]pyridine, 6-methyl-2-phenyl-3-(4-thiomorpholinylmethyl)-
• 6-Methyl-2-phenyl-3-(4-thiomorpholinylmethyl)imidazo[1,2-a]pyridine