CAS 861212-71-7
:6-[(4-Chlorophenyl)sulfonyl]-1-oxa-6-azaspiro[2.5]octane
Description:
6-[(4-Chlorophenyl)sulfonyl]-1-oxa-6-azaspiro[2.5]octane is a chemical compound characterized by its unique spirocyclic structure, which incorporates both an oxa (oxygen-containing) and azaspiro (nitrogen-containing) moiety. The presence of a sulfonyl group attached to a 4-chlorophenyl ring contributes to its potential reactivity and biological activity. This compound may exhibit properties typical of sulfonamides, including antimicrobial or anti-inflammatory effects, although specific biological activities would depend on further empirical studies. The spiro structure can influence the compound's conformation and steric interactions, potentially affecting its pharmacokinetics and pharmacodynamics. Additionally, the chlorine substituent on the phenyl ring may enhance lipophilicity, impacting the compound's solubility and permeability. Overall, 6-[(4-Chlorophenyl)sulfonyl]-1-oxa-6-azaspiro[2.5]octane represents a class of compounds that may be of interest in medicinal chemistry and drug development, warranting further investigation into its properties and applications.
Formula:C12H14ClNO3S
InChI:InChI=1S/C12H14ClNO3S/c13-10-1-3-11(4-2-10)18(15,16)14-7-5-12(6-8-14)9-17-12/h1-4H,5-9H2
InChI key:InChIKey=MJCCEIXTLSRFSF-UHFFFAOYSA-N
SMILES:S(=O)(=O)(N1CCC2(CC1)CO2)C3=CC=C(Cl)C=C3
Synonyms:- 1-Oxa-6-azaspiro[2.5]octane, 6-[(4-chlorophenyl)sulfonyl]-
- 6-[(4-Chlorophenyl)sulfonyl]-1-oxa-6-azaspiro[2.5]octane
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 1 products.
6-(4-Chlorobenzenesulfonyl)-1-oxa-6-azaspiro[2.5]octane
CAS:<p>6-(4-Chlorobenzenesulfonyl)-1-oxa-6-azaspiro[2.5]octane</p>Purity:techMolecular weight:287.76g/mol
