
CAS 861212-73-9
:1-[[1-[(4-Chlorophenyl)sulfonyl]-4-hydroxy-4-piperidinyl]methyl]-4-piperidinone
Description:
1-[[1-[(4-Chlorophenyl)sulfonyl]-4-hydroxy-4-piperidinyl]methyl]-4-piperidinone, with CAS number 861212-73-9, is a synthetic organic compound characterized by its complex structure, which includes a piperidinone core and a sulfonyl group attached to a chlorophenyl moiety. This compound typically exhibits properties associated with piperidine derivatives, such as potential psychoactive effects and interactions with neurotransmitter systems. The presence of the sulfonyl group may enhance its solubility and reactivity, making it suitable for various applications in medicinal chemistry. The hydroxyl group contributes to its potential as a hydrogen bond donor, influencing its biological activity and interactions with target proteins. Additionally, the chlorophenyl substituent may impart specific pharmacological properties, potentially affecting its efficacy and safety profile. Overall, this compound is of interest in research contexts, particularly in the development of therapeutic agents targeting neurological or psychiatric disorders. However, detailed studies are necessary to fully elucidate its biological activity and potential applications.
Formula:C17H23ClN2O4S
InChI:InChI=1S/C17H23ClN2O4S/c18-14-1-3-16(4-2-14)25(23,24)20-11-7-17(22,8-12-20)13-19-9-5-15(21)6-10-19/h1-4,22H,5-13H2
InChI key:InChIKey=LMFMTLOPUSQZNE-UHFFFAOYSA-N
SMILES:S(=O)(=O)(N1CCC(CN2CCC(=O)CC2)(O)CC1)C3=CC=C(Cl)C=C3
Synonyms:- 1-[[1-[(4-Chlorophenyl)sulfonyl]-4-hydroxy-4-piperidinyl]methyl]-4-piperidinone
- 4-Piperidinone, 1-[[1-[(4-chlorophenyl)sulfonyl]-4-hydroxy-4-piperidinyl]methyl]-
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.