CAS 861218-72-6
:methyl 4-cyanobenzothiophene-2-carboxylate
Description:
Methyl 4-cyanobenzothiophene-2-carboxylate is an organic compound characterized by its unique structure, which includes a benzothiophene core, a cyano group, and a carboxylate ester functionality. This compound typically exhibits a solid state at room temperature and is soluble in organic solvents, reflecting its non-polar characteristics due to the presence of the aromatic system. The cyano group contributes to its reactivity, making it a potential candidate for various chemical reactions, including nucleophilic additions and cycloadditions. The presence of the thiophene ring imparts distinct electronic properties, which can influence its behavior in electronic applications, such as organic semiconductors. Additionally, the methyl ester group enhances its stability and solubility, making it suitable for further functionalization in synthetic chemistry. Overall, methyl 4-cyanobenzothiophene-2-carboxylate is of interest in materials science and organic synthesis due to its versatile chemical properties and potential applications in pharmaceuticals and agrochemicals.
Formula:C11H7NO2S
InChI:InChI=1/C11H7NO2S/c1-14-11(13)10-5-8-7(6-12)3-2-4-9(8)15-10/h2-5H,1H3
SMILES:COC(=O)c1cc2c(cccc2s1)C#N
Synonyms:- Methyl 4-Cyano-1-Benzothiophene-2-Carboxylate
- Methyl-4-cyan-1-benzothiophen-2-carboxylat
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 1 products.
Methyl 4-cyanobenzo[b]thiophene-2-carboxylate
CAS:Formula:C11H7NO2SColor and Shape:SolidMolecular weight:217.2438

