CAS 861224-60-4

N-(4-Amino-2-chlorophenyl)benzeneacetamide

Description:

N-(4-Amino-2-chlorophenyl)benzeneacetamide, with the CAS number 861224-60-4, is an organic compound characterized by its amide functional group and aromatic structure. This substance features a benzene ring substituted with an acetamide group and an amino group, as well as a chlorine atom, which contributes to its unique chemical properties. The presence of the amino group suggests potential for hydrogen bonding, influencing its solubility and reactivity. The chlorine atom can affect the compound's electronic properties and steric hindrance, which may play a role in its biological activity. Typically, compounds of this nature are investigated for their potential pharmaceutical applications, particularly in the development of therapeutic agents. The molecular structure allows for various interactions with biological targets, making it a candidate for further research in medicinal chemistry. Additionally, its stability and reactivity can be influenced by environmental factors such as pH and temperature, which are important considerations in both laboratory and industrial settings.

Formula: C₁₄H₁₃ClN₂O

InChI: InChI=1S/C14H13ClN2O/c15-12-9-11(16)6-7-13(12)17-14(18)8-10-4-2-1-3-5-10/h1-7,9H,8,16H2,(H,17,18)

InChI key: InChIKey=LNHXXKGZCHMAPE-UHFFFAOYSA-N

SMILES: N(C(CC1=CC=CC=C1)=O)C2=C(Cl)C=C(N)C=C2

Synonyms:

• N-(4-Amino-2-chlorophenyl)benzeneacetamide
• Benzeneacetamide, N-(4-amino-2-chlorophenyl)-