CAS 861229-15-4
:Mecoprop-P 2-ethylhexyl ester
Description:
Mecoprop-P 2-ethylhexyl ester, identified by its CAS number 861229-15-4, is a synthetic herbicide belonging to the phenoxyalkanoic acid family. It is primarily used for controlling broadleaf weeds in various agricultural and non-agricultural settings. This compound exhibits selective herbicidal activity, targeting specific plant species while minimizing harm to grasses and other desirable plants. Mecoprop-P 2-ethylhexyl ester is characterized by its lipophilic nature, which enhances its ability to penetrate plant tissues. It typically acts by mimicking natural plant hormones, leading to uncontrolled growth and eventual plant death. The substance is generally applied in formulations that may include emulsifiable concentrates or granules, facilitating its application in diverse environments. Safety and environmental impact assessments are crucial, as with any pesticide, to ensure responsible use and minimize potential risks to non-target organisms and ecosystems. Proper handling and application guidelines are essential to maximize efficacy while adhering to regulatory standards.
Formula:C18H27ClO3
InChI:InChI=1S/C18H27ClO3/c1-5-7-8-15(6-2)12-21-18(20)14(4)22-17-10-9-16(19)11-13(17)3/h9-11,14-15H,5-8,12H2,1-4H3/t14-,15?/m1/s1
InChI key:InChIKey=NWTKQOOQEPXMMW-GICMACPYSA-N
SMILES:O([C@@H](C(OCC(CCCC)CC)=O)C)C1=C(C)C=C(Cl)C=C1
Synonyms:- Propanoic acid, 2-(4-chloro-2-methylphenoxy)-, 2-ethylhexyl ester, (2R)-
- Mecoprop-P 2-ethylhexyl ester
- Mecoprop-P-2-butoxyethyl Ester
- 2-Ethylhexyl (R)-2-(2-methyl-4chlorophenoxy)propionate
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 1 products.
Mecoprop-P-2-butoxyethyl Ester
CAS:Controlled ProductFormula:C16H23ClO4Color and Shape:NeatMolecular weight:314.804
