CAS 86128-83-8
:3-noradamantanamine hydrochloride
Description:
3-Noradamantanamine hydrochloride, with the CAS number 86128-83-8, is a chemical compound that belongs to the class of amines and is structurally related to adamantane. It is characterized by its bicyclic structure, which contributes to its unique properties. This compound is typically encountered as a hydrochloride salt, enhancing its solubility in water and making it suitable for various applications, particularly in medicinal chemistry. 3-Noradamantanamine exhibits potential antiviral activity, particularly against certain strains of influenza, and has been studied for its neuroprotective effects. The compound's mechanism of action may involve interference with viral replication or modulation of neurotransmitter systems. In terms of physical properties, it is generally a white to off-white crystalline solid. Safety data indicates that, like many amines, it should be handled with care, as it may cause irritation upon contact with skin or mucous membranes. Overall, 3-noradamantanamine hydrochloride represents a compound of interest in both pharmaceutical research and potential therapeutic applications.
Formula:C9H16ClN
InChI:InChI=1/C9H15N.ClH/c10-9-4-6-1-7(5-9)3-8(9)2-6;/h6-8H,1-5,10H2;1H
SMILES:C1C2CC3CC1CC3(C2)N.Cl
Synonyms:- hexahydro-2,5-methanopentalen-3a(1H)-amine hydrochloride (1:1)
Sort by
Purity (%)
0
100
|
0
|
50
|
90
|
95
|
100
Found 5 products.
3-Noradamantanamine Hydrochloride
CAS:Formula:C9H15N·HClPurity:>98.0%(T)Color and Shape:White to Almost white powder to crystalMolecular weight:173.68Octahydro-2,5-methanopentalen-3a-amine hydrochloride
CAS:Formula:C9H16ClNPurity:98%Color and Shape:SolidMolecular weight:173.68303-Aminonoradamantane Hydrochloride
CAS:3-Aminonoradamantane HydrochloridePurity:98%Molecular weight:173.68g/mol3-Noradamantaneamine hydrochloride
CAS:<p>3-Noradamantaneamine hydrochloride is a thioamide that has inhibitory activities on biological processes, such as the production of tumor necrosis factor-α (TNF-α). 3-Noradamantaneamine hydrochloride also inhibits angiogenesis and the proliferation of endothelial cells. The drug was shown to be neuroprotective in animal models and to have anti-angiogenic properties. The mechanism of action is not yet clear, but may involve nitric oxide synthase inhibition or nitration of the drug.</p>Formula:C9H15N·HClPurity:Min. 95%Color and Shape:White PowderMolecular weight:173.68 g/molRef: 3D-FN67894
Discontinued product




