CAS 86129-54-6

6-chloro-3-methyl-2,3,4,5-tetrahydro-1H-3-benzazepine hydrochloride (1:1)

Description:

6-Chloro-3-methyl-2,3,4,5-tetrahydro-1H-3-benzazepine hydrochloride is a chemical compound characterized by its bicyclic structure, which includes a benzene ring fused to a seven-membered nitrogen-containing ring. This compound features a chlorine atom and a methyl group, contributing to its unique reactivity and potential biological activity. As a hydrochloride salt, it is typically more soluble in water compared to its free base form, enhancing its utility in pharmaceutical applications. The presence of the tetrahydro structure indicates that it is a saturated derivative, which may influence its pharmacokinetic properties, such as absorption and metabolism. This compound is of interest in medicinal chemistry, particularly for its potential effects on the central nervous system, as benzazepines are often explored for their neuroactive properties. Safety and handling precautions should be observed, as with all chemical substances, due to potential toxicity and the need for proper laboratory practices.

Formula: C₁₁H₁₅Cl₂N

InChI: InChI=1/C11H14ClN.ClH/c1-13-7-5-9-3-2-4-11(12)10(9)6-8-13;/h2-4H,5-8H2,1H3;1H

SMILES: CN1CCc2cccc(c2CC1)Cl.Cl

Synonyms:

• 1H-3-benzazepine, 6-chloro-2,3,4,5-tetrahydro-3-methyl-, hydrochloride (1:1)

SKF-86466 hydrochloride

CAS: 86129-54-6

Formula: C₁₁H₁₄ClN·HCl

Molecular weight: 232.15

Ref: 7W-GL2488

SKF-86466 Hydrochloride

Controlled Product

CAS: 86129-54-6

Formula: C₁₁H₁₄ClN·ClH

Color and Shape: Neat

Molecular weight: 232.149

Ref: TR-S550090

SKF 86466 hydrochloride

CAS: 86129-54-6

SKF 86466 hydrochloride is an α2-adrenoceptor antagonist.

Formula: C₁₁H₁₅Cl₂N

Purity: 98%

Color and Shape: Solid

Molecular weight: 232.15

Ref: TM-T23366