CAS 861307-17-7
:(3-chloro-4-methyl-phenyl)-(2-chlorophenyl)methanone
Description:
(3-chloro-4-methyl-phenyl)-(2-chlorophenyl)methanone, identified by its CAS number 861307-17-7, is an organic compound characterized by its ketone functional group and aromatic structure. This compound features a phenyl ring substituted with both chlorine and methyl groups, contributing to its unique chemical properties. The presence of the chlorinated phenyl groups enhances its reactivity and may influence its biological activity, making it of interest in pharmaceutical and agrochemical research. The molecular structure suggests potential applications in synthesis and as an intermediate in various chemical reactions. Additionally, the compound's physical properties, such as solubility and melting point, are influenced by the substituents on the aromatic rings, which can affect its interactions in different environments. Safety and handling considerations are essential due to the presence of chlorine atoms, which can pose health risks. Overall, this compound exemplifies the complexity and utility of chlorinated aromatic ketones in organic chemistry.
Formula:C14H10Cl2O
InChI:InChI=1/C14H10Cl2O/c1-9-6-7-10(8-13(9)16)14(17)11-4-2-3-5-12(11)15/h2-8H,1H3
SMILES:Cc1ccc(cc1Cl)C(=O)c1ccccc1Cl
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.