CymitQuimica logo

CAS 861317-20-6

:

1-[(4-methylphenyl)amino]cyclopentanecarboxylic acid

Description:
1-[(4-Methylphenyl)amino]cyclopentanecarboxylic acid, identified by its CAS number 861317-20-6, is an organic compound characterized by its cyclopentane structure substituted with an amino group and a carboxylic acid functional group. The presence of the 4-methylphenyl group indicates that there is a methyl group attached to the phenyl ring, which can influence the compound's solubility and reactivity. This compound is likely to exhibit both acidic and basic properties due to the carboxylic acid and amino functionalities, respectively. It may participate in various chemical reactions, including amide formation and esterification, and could serve as a potential building block in pharmaceutical synthesis or organic chemistry research. The structural features suggest that it may have specific interactions with biological targets, making it of interest in medicinal chemistry. Additionally, its physical properties, such as melting point, boiling point, and solubility, would depend on the specific molecular interactions and the presence of functional groups.
Formula:C13H17NO2
InChI:InChI=1/C13H17NO2/c1-10-4-6-11(7-5-10)14-13(12(15)16)8-2-3-9-13/h4-7,14H,2-3,8-9H2,1H3,(H,15,16)
SMILES:Cc1ccc(cc1)NC1(CCCC1)C(=O)O
Synonyms:
  • Cyclopentanecarboxylic Acid, 1-[(4-Methylphenyl)Amino]-
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 1 products.