CAS 861363-66-8

3-nitro-N-[(2,4,6-trichlorophenyl)amino]benzimidoyl chloride

Description:

3-nitro-N-[(2,4,6-trichlorophenyl)amino]benzimidoyl chloride, with the CAS number 861363-66-8, is a chemical compound characterized by its complex structure, which includes a benzimidoyl moiety and a nitro group. This compound features a chlorinated aromatic ring, specifically a 2,4,6-trichlorophenyl group, which contributes to its chemical reactivity and potential applications in various fields, including pharmaceuticals and agrochemicals. The presence of the nitro group indicates that it may participate in electrophilic substitution reactions, while the benzimidoyl chloride functional group suggests reactivity towards nucleophiles. The compound is likely to be a solid at room temperature and may exhibit moderate to high stability under standard conditions, although it should be handled with care due to the presence of chlorine and nitro functionalities, which can impart toxicity and environmental concerns. As with many chlorinated compounds, it may also have implications for environmental persistence and bioaccumulation. Proper safety measures should be taken when handling this substance in laboratory or industrial settings.

Formula: C₁₃H₇Cl₄N₃O₂

InChI: InChI=1/C13H7Cl4N3O2/c14-8-5-10(15)12(11(16)6-8)18-19-13(17)7-2-1-3-9(4-7)20(21)22/h1-6,18H/b19-13+

N-(2,4,6-Trichlorophenyl)-3-nitrobenzenecarbohydrazonoyl chloride

CAS: 861363-66-8

Formula: C₁₃H₇Cl₄N₃O₂

Molecular weight: 379.02

Ref: 10-F035433