CAS 86138-01-4
:triethoxy[4-(oxiran-2-yl)butyl]silane
Description:
Triethoxy[4-(oxiran-2-yl)butyl]silane, with the CAS number 86138-01-4, is an organosilicon compound characterized by the presence of a silane group attached to a butyl chain that includes an epoxide (oxirane) functional group. This compound typically exhibits properties such as good adhesion to various substrates, making it useful in applications like sealants, adhesives, and coatings. The triethoxy groups enhance its reactivity and solubility in organic solvents, while the epoxide functionality can participate in further chemical reactions, such as ring-opening polymerization or cross-linking, under appropriate conditions. Its structure allows for potential applications in modifying surfaces or as a coupling agent in composite materials. Additionally, triethoxy[4-(oxiran-2-yl)butyl]silane may exhibit hydrophobic characteristics due to the silane component, which can improve the water resistance of treated surfaces. Safety data sheets should be consulted for handling and toxicity information, as with any chemical substance.
Formula:C12H26O4Si
InChI:InChI=1/C12H26O4Si/c1-4-14-17(15-5-2,16-6-3)10-8-7-9-12-11-13-12/h12H,4-11H2,1-3H3
SMILES:CCO[Si](CCCCC1CO1)(OCC)OCC
Synonyms:- 5,6-Epoxyhexyltriethoxysilane
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 1 products.
5,6-Epoxyhexyltriethoxysilane
CAS:S25146 - 5,6-Epoxyhexyltriethoxysilane
Formula:C12H26O4SiColor and Shape:Clear to straw liquidMolecular weight:262.421
