CAS 861406-07-7

7-Azabicyclo[2.2.1]heptane-7-carbonyl chloride

Description:

7-Azabicyclo[2.2.1]heptane-7-carbonyl chloride, identified by its CAS number 861406-07-7, is a bicyclic organic compound featuring a nitrogen atom within its bicyclic structure. This compound is characterized by the presence of a carbonyl chloride functional group, which contributes to its reactivity, particularly in nucleophilic substitution reactions. The bicyclic framework consists of a seven-membered ring that includes a nitrogen atom, making it a member of the azabicyclic family. The carbonyl chloride group enhances its utility in organic synthesis, allowing for the introduction of various functional groups through reactions with nucleophiles. The compound is typically a solid at room temperature and may exhibit moderate to high reactivity due to the presence of the carbonyl chloride, which can release hydrochloric acid upon reaction. Its applications may extend to medicinal chemistry and the synthesis of more complex organic molecules, although specific applications would depend on further research and development. Proper handling and storage are essential due to its reactive nature and potential hazards associated with the carbonyl chloride moiety.

Formula: C₇H₁₀ClNO

InChI: InChI=1S/C7H10ClNO/c8-7(10)9-5-1-2-6(9)4-3-5/h5-6H,1-4H2

InChI key: InChIKey=HWCHBLKQZPTVFW-UHFFFAOYSA-N

SMILES: C(Cl)(=O)N1C2CCC1CC2

Synonyms:

• 7-Azabicyclo[2.2.1]heptane-7-carbonyl chloride